C13H11F17O3S2 — CID 139975084
[dimethyl(prop-2-enyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate (PubChem CID 139975084) has the molecular formula C13H11F17O3S2 and a molecular weight of 602.33 g/mol. Its IUPAC name is [dimethyl(prop-2-enyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate.
| Compound Name | [dimethyl(prop-2-enyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 139975084 |
| Molecular Formula | C13H11F17O3S2 |
| Molecular Weight | 602.33 g/mol |
| Exact Mass | 601.99 |
| IUPAC Name | [dimethyl(prop-2-enyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
| SMILES | C=CCS(C)(C)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H11F17O3S2/c1-4-5-34(2,3)33-35(31,32)13(29,30)11(24,25)9(20,21)7(16,17)6(14,15)8(18,19)10(22,23)12(26,27)28/h4H,1,5H2,2-3H3 |
| InChIKey | CGUZDGZVQDFBCT-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.33 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|