C9H5F13O2S — CID 11531931
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-[(E)-prop-1-enyl]sulfonylhexane (PubChem CID 11531931) has the molecular formula C9H5F13O2S and a molecular weight of 424.18 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-[(E)-prop-1-enyl]sulfonylhexane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-[(E)-prop-1-enyl]sulfonylhexane |
|---|---|
| PubChem CID | 11531931 |
| Molecular Formula | C9H5F13O2S |
| Molecular Weight | 424.18 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-[(E)-prop-1-enyl]sulfonylhexane |
| SMILES | C/C=C/S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5F13O2S/c1-2-3-25(23,24)9(21,22)7(16,17)5(12,13)4(10,11)6(14,15)8(18,19)20/h2-3H,1H3/b3-2+ |
| InChIKey | UKZZLEPPYUSANN-NSCUHMNNSA-N |
| XLogP | 4.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.18 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|