C10H7F13O2S — CID 56605515
1-ethylsulfonyl-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-ene (PubChem CID 56605515) has the molecular formula C10H7F13O2S and a molecular weight of 438.21 g/mol. Its IUPAC name is 1-ethylsulfonyl-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-ene.
| Compound Name | 1-ethylsulfonyl-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-ene |
|---|---|
| PubChem CID | 56605515 |
| Molecular Formula | C10H7F13O2S |
| Molecular Weight | 438.21 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 1-ethylsulfonyl-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-ene |
| SMILES | CCS(=O)(=O)C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H7F13O2S/c1-2-26(24,25)4-3-5(11,12)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)23/h3-4H,2H2,1H3 |
| InChIKey | MSHMCYZXTHKTOJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.21 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|