C12H7F17O2S — CID 56617655
1-ethylsulfonyl-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodec-1-ene (PubChem CID 56617655) has the molecular formula C12H7F17O2S and a molecular weight of 538.22 g/mol. Its IUPAC name is 1-ethylsulfonyl-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodec-1-ene.
| Compound Name | 1-ethylsulfonyl-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodec-1-ene |
|---|---|
| PubChem CID | 56617655 |
| Molecular Formula | C12H7F17O2S |
| Molecular Weight | 538.22 g/mol |
| Exact Mass | 537.99 |
| IUPAC Name | 1-ethylsulfonyl-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodec-1-ene |
| SMILES | CCS(=O)(=O)C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H7F17O2S/c1-2-32(30,31)4-3-5(13,14)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)29/h3-4H,2H2,1H3 |
| InChIKey | UCXDKTXJJWJKSQ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.22 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|