C8H5F11O3S2 — CID 139974983
prop-2-enylsulfanyl 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate (PubChem CID 139974983) has the molecular formula C8H5F11O3S2 and a molecular weight of 422.24 g/mol. Its IUPAC name is prop-2-enylsulfanyl 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate.
| Compound Name | prop-2-enylsulfanyl 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 139974983 |
| Molecular Formula | C8H5F11O3S2 |
| Molecular Weight | 422.24 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | prop-2-enylsulfanyl 1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate |
| SMILES | C=CCSOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F11O3S2/c1-2-3-23-22-24(20,21)8(18,19)6(13,14)4(9,10)5(11,12)7(15,16)17/h2H,1,3H2 |
| InChIKey | LPIJDMHMSCMGGI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|