C6H5F7O3S2 — CID 139974888
prop-2-enylsulfanyl 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate (PubChem CID 139974888) has the molecular formula C6H5F7O3S2 and a molecular weight of 322.22 g/mol. Its IUPAC name is prop-2-enylsulfanyl 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate.
| Compound Name | prop-2-enylsulfanyl 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 139974888 |
| Molecular Formula | C6H5F7O3S2 |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | prop-2-enylsulfanyl 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate |
| SMILES | C=CCSOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F7O3S2/c1-2-3-17-16-18(14,15)6(12,13)4(7,8)5(9,10)11/h2H,1,3H2 |
| InChIKey | SWMSIEXWNKHTFB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|