C4H5F3NO4S2- — CID 59046752
prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide (PubChem CID 59046752) has the molecular formula C4H5F3NO4S2- and a molecular weight of 252.21 g/mol. Its IUPAC name is prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide.
| Compound Name | prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 59046752 |
| Molecular Formula | C4H5F3NO4S2- |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | prop-2-enylsulfonyl(trifluoromethylsulfonyl)azanide |
| SMILES | C=CCS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C4H5F3NO4S2/c1-2-3-13(9,10)8-14(11,12)4(5,6)7/h2H,1,3H2/q-1 |
| InChIKey | HFKYWXUNQZOBCB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|