C5H6F5NO4S2 — CID 20705408
N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide (PubChem CID 20705408) has the molecular formula C5H6F5NO4S2 and a molecular weight of 303.23 g/mol. Its IUPAC name is N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide.
| Compound Name | N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 20705408 |
| Molecular Formula | C5H6F5NO4S2 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide |
| SMILES | C=CCS(=O)(=O)N=S(=O)(OC(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H6F5NO4S2/c1-2-3-16(12,13)11-17(14,5(8,9)10)15-4(6)7/h2,4H,1,3H2 |
| InChIKey | KMEYJUISWJUJSZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|