C5H5F6N2O5S3- — CID 20750477
[N-prop-2-enylsulfonyl-S-(trifluoromethyl)sulfonimidoyl]-(trifluoromethylsulfonyl)azanide (PubChem CID 20750477) has the molecular formula C5H5F6N2O5S3- and a molecular weight of 383.29 g/mol. Its IUPAC name is [N-prop-2-enylsulfonyl-S-(trifluoromethyl)sulfonimidoyl]-(trifluoromethylsulfonyl)azanide.
| Compound Name | [N-prop-2-enylsulfonyl-S-(trifluoromethyl)sulfonimidoyl]-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 20750477 |
| Molecular Formula | C5H5F6N2O5S3- |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.93 |
| IUPAC Name | [N-prop-2-enylsulfonyl-S-(trifluoromethyl)sulfonimidoyl]-(trifluoromethylsulfonyl)azanide |
| SMILES | C=CCS(=O)(=O)N=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H5F6N2O5S3/c1-2-3-19(14,15)12-20(16,4(6,7)8)13-21(17,18)5(9,10)11/h2H,1,3H2/q-1 |
| InChIKey | HSQBBQMMGIVIQO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 111.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|