C4H6F3NO4S2 — CID 20705422
[S-(difluoromethyl)-N-prop-2-enylsulfonylsulfonimidoyl] hypofluorite (PubChem CID 20705422) has the molecular formula C4H6F3NO4S2 and a molecular weight of 253.22 g/mol. Its IUPAC name is [S-(difluoromethyl)-N-prop-2-enylsulfonylsulfonimidoyl] hypofluorite.
| Compound Name | [S-(difluoromethyl)-N-prop-2-enylsulfonylsulfonimidoyl] hypofluorite |
|---|---|
| PubChem CID | 20705422 |
| Molecular Formula | C4H6F3NO4S2 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | [S-(difluoromethyl)-N-prop-2-enylsulfonylsulfonimidoyl] hypofluorite |
| SMILES | C=CCS(=O)(=O)N=S(=O)(OF)C(F)F |
| InChI | InChI=1S/C4H6F3NO4S2/c1-2-3-13(9,10)8-14(11,12-7)4(5)6/h2,4H,1,3H2 |
| InChIKey | GABYDIULKXJQQR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|