C5H6F6N2O5S3 — CID 90726522
1,1,1-trifluoro-N-prop-2-enylsulfonyl-N'-(trifluoromethylsulfonyl)methanesulfonodiimidic acid (PubChem CID 90726522) has the molecular formula C5H6F6N2O5S3 and a molecular weight of 384.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-prop-2-enylsulfonyl-N'-(trifluoromethylsulfonyl)methanesulfonodiimidic acid.
| Compound Name | 1,1,1-trifluoro-N-prop-2-enylsulfonyl-N'-(trifluoromethylsulfonyl)methanesulfonodiimidic acid |
|---|---|
| PubChem CID | 90726522 |
| Molecular Formula | C5H6F6N2O5S3 |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | 1,1,1-trifluoro-N-prop-2-enylsulfonyl-N'-(trifluoromethylsulfonyl)methanesulfonodiimidic acid |
| SMILES | C=CCS(=O)(=O)N=S(O)(=NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H6F6N2O5S3/c1-2-3-19(14,15)12-20(16,4(6,7)8)13-21(17,18)5(9,10)11/h2H,1,3H2,(H,12,13,16) |
| InChIKey | ZMSNLNMOMZIRTM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|