About ethyl 10,10-dimethyl-6-oxaspiro[4.5]dec-7-ene-4-carboxylate
ethyl 10,10-dimethyl-6-oxaspiro[4.5]dec-7-ene-4-carboxylate (PubChem CID 15352877) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is ethyl 10,10-dimethyl-6-oxaspiro[4.5]dec-7-ene-4-carboxylate.
Analyze ethyl 10,10-dimethyl-6-oxaspiro[4.5]dec-7-ene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 10,10-dimethyl-6-oxaspiro[4.5]dec-7-ene-4-carboxylate?
The IUPAC name of ethyl 10,10-dimethyl-6-oxaspiro[4.5]dec-7-ene-4-carboxylate (CID 15352877) is ethyl 10,10-dimethyl-6-oxaspiro[4.5]dec-7-ene-4-carboxylate.
What is the SMILES notation for ethyl 10,10-dimethyl-6-oxaspiro[4.5]dec-7-ene-4-carboxylate?
The canonical SMILES for ethyl 10,10-dimethyl-6-oxaspiro[4.5]dec-7-ene-4-carboxylate is CCOC(=O)C1CCCC12OC=CCC2(C)C.
What is the InChIKey of ethyl 10,10-dimethyl-6-oxaspiro[4.5]dec-7-ene-4-carboxylate?
The InChIKey is NXMMMFZDHJYRGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3/c1-4-16-12(15)11-7-5-9-14(11)13(2,3)8-6-10-17-14/h6,10-11H,4-5,7-9H2,1-3H3.
What are the key properties of ethyl 10,10-dimethyl-6-oxaspiro[4.5]dec-7-ene-4-carboxylate?
ethyl 10,10-dimethyl-6-oxaspiro[4.5]dec-7-ene-4-carboxylate has a molecular weight of 238.33 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 10,10-dimethyl-6-oxaspiro[4.5]dec-7-ene-4-carboxylate is sourced from PubChem (CID 15352877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).