C16H13NO2S2 — CID 15354638
4-(4-methylphenyl)sulfonyl-2-phenyl-1,3-thiazole (PubChem CID 15354638) has the molecular formula C16H13NO2S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyl-2-phenyl-1,3-thiazole.
| Compound Name | 4-(4-methylphenyl)sulfonyl-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 15354638 |
| Molecular Formula | C16H13NO2S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyl-2-phenyl-1,3-thiazole |
| SMILES | Cc1ccc(S(=O)(=O)c2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C16H13NO2S2/c1-12-7-9-14(10-8-12)21(18,19)15-11-20-16(17-15)13-5-3-2-4-6-13/h2-11H,1H3 |
| InChIKey | YZAMVSQPFOKJOA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |