C21H27F3 — CID 15354982
2-tert-butyl-2-[4-(trifluoromethyl)phenyl]adamantane (PubChem CID 15354982) has the molecular formula C21H27F3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-tert-butyl-2-[4-(trifluoromethyl)phenyl]adamantane.
| Compound Name | 2-tert-butyl-2-[4-(trifluoromethyl)phenyl]adamantane |
|---|---|
| PubChem CID | 15354982 |
| Molecular Formula | C21H27F3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 2-tert-butyl-2-[4-(trifluoromethyl)phenyl]adamantane |
| SMILES | CC(C)(C)C1(c2ccc(C(F)(F)F)cc2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C21H27F3/c1-19(2,3)20(15-4-6-16(7-5-15)21(22,23)24)17-9-13-8-14(11-17)12-18(20)10-13/h4-7,13-14,17-18H,8-12H2,1-3H3 |
| InChIKey | BAMXKDNDFZHCSP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |