C11H13N5O4 — CID 15361523
ethyl 4-[(2E)-2-(1-cyano-2-ethoxy-2-oxoethylidene)hydrazinyl]-1H-imidazole-5-carboxylate (PubChem CID 15361523) has the molecular formula C11H13N5O4 and a molecular weight of 279.26 g/mol. Its IUPAC name is ethyl 4-[(2E)-2-(1-cyano-2-ethoxy-2-oxoethylidene)hydrazinyl]-1H-imidazole-5-carboxylate.
| Compound Name | ethyl 4-[(2E)-2-(1-cyano-2-ethoxy-2-oxoethylidene)hydrazinyl]-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 15361523 |
| Molecular Formula | C11H13N5O4 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | ethyl 4-[(2E)-2-(1-cyano-2-ethoxy-2-oxoethylidene)hydrazinyl]-1H-imidazole-5-carboxylate |
| SMILES | CCOC(=O)/C(C#N)=N/Nc1nc[nH]c1C(=O)OCC |
| InChI | InChI=1S/C11H13N5O4/c1-3-19-10(17)7(5-12)15-16-9-8(13-6-14-9)11(18)20-4-2/h6,16H,3-4H2,1-2H3,(H,13,14)/b15-7+ |
| InChIKey | FXXCMKGSOPGXKL-VIZOYTHASA-N |
| XLogP | 0.44 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|