C25H21ClO3 — CID 15364465
1-chloro-2-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]-7-methoxyphenanthrene (PubChem CID 15364465) has the molecular formula C25H21ClO3 and a molecular weight of 404.89 g/mol. Its IUPAC name is 1-chloro-2-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]-7-methoxyphenanthrene.
| Compound Name | 1-chloro-2-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]-7-methoxyphenanthrene |
|---|---|
| PubChem CID | 15364465 |
| Molecular Formula | C25H21ClO3 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 1-chloro-2-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]-7-methoxyphenanthrene |
| SMILES | COc1ccc2c(ccc3c(Cl)c(/C=C/c4cccc(OC)c4OC)ccc32)c1 |
| InChI | InChI=1S/C25H21ClO3/c1-27-19-11-14-20-18(15-19)10-13-22-21(20)12-9-16(24(22)26)7-8-17-5-4-6-23(28-2)25(17)29-3/h4-15H,1-3H3/b8-7+ |
| InChIKey | LRXLRIHMARUNBL-BQYQJAHWSA-N |
| XLogP | 6.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|