C14H14N2O4 — CID 15366547
1,3-bis(oxiran-2-ylmethyl)quinazoline-2,4-dione (PubChem CID 15366547) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1,3-bis(oxiran-2-ylmethyl)quinazoline-2,4-dione.
| Compound Name | 1,3-bis(oxiran-2-ylmethyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 15366547 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1,3-bis(oxiran-2-ylmethyl)quinazoline-2,4-dione |
| SMILES | O=c1c2ccccc2n(CC2CO2)c(=O)n1CC1CO1 |
| InChI | InChI=1S/C14H14N2O4/c17-13-11-3-1-2-4-12(11)15(5-9-7-19-9)14(18)16(13)6-10-8-20-10/h1-4,9-10H,5-8H2 |
| InChIKey | PSKOKJIJIOBDMN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|