C15H14O4 — CID 15369388
3-(4-hydroxyphenyl)-2,5-dimethoxybenzaldehyde (PubChem CID 15369388) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2,5-dimethoxybenzaldehyde.
| Compound Name | 3-(4-hydroxyphenyl)-2,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 15369388 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)c(OC)c(-c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C15H14O4/c1-18-13-7-11(9-16)15(19-2)14(8-13)10-3-5-12(17)6-4-10/h3-9,17H,1-2H3 |
| InChIKey | DCEQGMKIWQJMNT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|