C15H24O2 — CID 15372999
(1R,4S,7R)-5-methyl-7-[(1S)-1,2,2-trimethylcyclopentyl]-2,3-dioxabicyclo[2.2.2]oct-5-ene (PubChem CID 15372999) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1R,4S,7R)-5-methyl-7-[(1S)-1,2,2-trimethylcyclopentyl]-2,3-dioxabicyclo[2.2.2]oct-5-ene.
| Compound Name | (1R,4S,7R)-5-methyl-7-[(1S)-1,2,2-trimethylcyclopentyl]-2,3-dioxabicyclo[2.2.2]oct-5-ene |
|---|---|
| PubChem CID | 15372999 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1R,4S,7R)-5-methyl-7-[(1S)-1,2,2-trimethylcyclopentyl]-2,3-dioxabicyclo[2.2.2]oct-5-ene |
| SMILES | CC1=C[C@H]2OO[C@H]1C[C@@H]2[C@]1(C)CCCC1(C)C |
| InChI | InChI=1S/C15H24O2/c1-10-8-13-11(9-12(10)16-17-13)15(4)7-5-6-14(15,2)3/h8,11-13H,5-7,9H2,1-4H3/t11-,12-,13+,15-/m0/s1 |
| InChIKey | QUOPFVBLFJCQJL-XPCVCDNBSA-N |
| XLogP | 3.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|