C11H12O2 — CID 15378024
(1R,6R)-1-hydroxybicyclo[4.4.1]undeca-3,7,9-trien-2-one (PubChem CID 15378024) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is (1R,6R)-1-hydroxybicyclo[4.4.1]undeca-3,7,9-trien-2-one.
| Compound Name | (1R,6R)-1-hydroxybicyclo[4.4.1]undeca-3,7,9-trien-2-one |
|---|---|
| PubChem CID | 15378024 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (1R,6R)-1-hydroxybicyclo[4.4.1]undeca-3,7,9-trien-2-one |
| SMILES | O=C1C=CC[C@H]2C=CC=C[C@]1(O)C2 |
| InChI | InChI=1S/C11H12O2/c12-10-6-3-5-9-4-1-2-7-11(10,13)8-9/h1-4,6-7,9,13H,5,8H2/t9-,11+/m1/s1 |
| InChIKey | OXZJQXLBZNLJAL-KOLCDFICSA-N |
| XLogP | 1.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |