C11H16O2 — CID 140987930
6-hydroxy-6-(3-methylbutyl)cyclohexa-2,4-dien-1-one (PubChem CID 140987930) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 6-hydroxy-6-(3-methylbutyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 6-hydroxy-6-(3-methylbutyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 140987930 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 6-hydroxy-6-(3-methylbutyl)cyclohexa-2,4-dien-1-one |
| SMILES | CC(C)CCC1(O)C=CC=CC1=O |
| InChI | InChI=1S/C11H16O2/c1-9(2)6-8-11(13)7-4-3-5-10(11)12/h3-5,7,9,13H,6,8H2,1-2H3 |
| InChIKey | MLRCUXQAPZBLBE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |