C17H24O4S — CID 15379226
[(2S)-2-hydroxy-2-[(1S)-4-methylcyclohex-3-en-1-yl]propyl] 4-methylbenzenesulfonate (PubChem CID 15379226) has the molecular formula C17H24O4S and a molecular weight of 324.44 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-[(1S)-4-methylcyclohex-3-en-1-yl]propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-hydroxy-2-[(1S)-4-methylcyclohex-3-en-1-yl]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15379226 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | [(2S)-2-hydroxy-2-[(1S)-4-methylcyclohex-3-en-1-yl]propyl] 4-methylbenzenesulfonate |
| SMILES | CC1=CC[C@@H]([C@](C)(O)COS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C17H24O4S/c1-13-4-8-15(9-5-13)17(3,18)12-21-22(19,20)16-10-6-14(2)7-11-16/h4,6-7,10-11,15,18H,5,8-9,12H2,1-3H3/t15-,17-/m1/s1 |
| InChIKey | XRRGNZZLGWDIDS-NVXWUHKLSA-N |
| XLogP | 3.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|