About 8-chloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one
8-chloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one (PubChem CID 15383054) has the molecular formula C8H9ClO4
and a molecular weight of 204.61 g/mol. Its IUPAC name is 8-chloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one.
Molecular Properties
| Compound Name | 8-chloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one |
| PubChem CID | 15383054 |
| Molecular Formula | C8H9ClO4 |
| Molecular Weight | 204.61 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 8-chloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one |
| SMILES | COC1=C(Cl)C(=O)CC12OCCO2 |
| InChI | InChI=1S/C8H9ClO4/c1-11-7-6(9)5(10)4-8(7)12-2-3-13-8/h2-4H2,1H3 |
| InChIKey | JLBCGEYHBLUQIK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.61 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one?
The IUPAC name of 8-chloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one (CID 15383054) is 8-chloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one.
What is the SMILES notation for 8-chloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one?
The canonical SMILES for 8-chloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one is COC1=C(Cl)C(=O)CC12OCCO2.
What is the InChIKey of 8-chloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one?
The InChIKey is JLBCGEYHBLUQIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO4/c1-11-7-6(9)5(10)4-8(7)12-2-3-13-8/h2-4H2,1H3.
What are the key properties of 8-chloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one?
8-chloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one has a molecular weight of 204.61 g/mol, XLogP of 0.80, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one is sourced from PubChem (CID 15383054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).