C8H8Cl2O4 — CID 706395
(6S)-6,8-dichloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one (PubChem CID 706395) has the molecular formula C8H8Cl2O4 and a molecular weight of 239.05 g/mol. Its IUPAC name is (6S)-6,8-dichloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one.
| Compound Name | (6S)-6,8-dichloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one |
|---|---|
| PubChem CID | 706395 |
| Molecular Formula | C8H8Cl2O4 |
| Molecular Weight | 239.05 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | (6S)-6,8-dichloro-9-methoxy-1,4-dioxaspiro[4.4]non-8-en-7-one |
| SMILES | COC1=C(Cl)C(=O)[C@H](Cl)C12OCCO2 |
| InChI | InChI=1S/C8H8Cl2O4/c1-12-7-4(9)5(11)6(10)8(7)13-2-3-14-8/h6H,2-3H2,1H3/t6-/m0/s1 |
| InChIKey | FDYYLKDOEKXSIQ-LURJTMIESA-N |
| XLogP | 1.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.05 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|