C10H10Cl2O4 — CID 15315374
6,8-dichloro-9-prop-2-enoxy-1,4-dioxaspiro[4.4]non-8-en-7-one (PubChem CID 15315374) has the molecular formula C10H10Cl2O4 and a molecular weight of 265.09 g/mol. Its IUPAC name is 6,8-dichloro-9-prop-2-enoxy-1,4-dioxaspiro[4.4]non-8-en-7-one.
| Compound Name | 6,8-dichloro-9-prop-2-enoxy-1,4-dioxaspiro[4.4]non-8-en-7-one |
|---|---|
| PubChem CID | 15315374 |
| Molecular Formula | C10H10Cl2O4 |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 6,8-dichloro-9-prop-2-enoxy-1,4-dioxaspiro[4.4]non-8-en-7-one |
| SMILES | C=CCOC1=C(Cl)C(=O)C(Cl)C12OCCO2 |
| InChI | InChI=1S/C10H10Cl2O4/c1-2-3-14-9-6(11)7(13)8(12)10(9)15-4-5-16-10/h2,8H,1,3-5H2 |
| InChIKey | DBXDNBAXIBPPSJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|