C10H10Cl2O4 — CID 15760607
1,3-dichloro-4-methoxy-6,11-dioxaspiro[4.6]undeca-3,8-dien-2-one (PubChem CID 15760607) has the molecular formula C10H10Cl2O4 and a molecular weight of 265.09 g/mol. Its IUPAC name is 1,3-dichloro-4-methoxy-6,11-dioxaspiro[4.6]undeca-3,8-dien-2-one.
| Compound Name | 1,3-dichloro-4-methoxy-6,11-dioxaspiro[4.6]undeca-3,8-dien-2-one |
|---|---|
| PubChem CID | 15760607 |
| Molecular Formula | C10H10Cl2O4 |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 1,3-dichloro-4-methoxy-6,11-dioxaspiro[4.6]undeca-3,8-dien-2-one |
| SMILES | COC1=C(Cl)C(=O)C(Cl)C12OCC=CCO2 |
| InChI | InChI=1S/C10H10Cl2O4/c1-14-9-6(11)7(13)8(12)10(9)15-4-2-3-5-16-10/h2-3,8H,4-5H2,1H3 |
| InChIKey | FJLLFSDFQQLGGT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|