C7H6Cl2O3 — CID 15346783
7,9-dichloro-1,4-dioxaspiro[4.4]non-6-en-8-one (PubChem CID 15346783) has the molecular formula C7H6Cl2O3 and a molecular weight of 209.03 g/mol. Its IUPAC name is 7,9-dichloro-1,4-dioxaspiro[4.4]non-6-en-8-one.
| Compound Name | 7,9-dichloro-1,4-dioxaspiro[4.4]non-6-en-8-one |
|---|---|
| PubChem CID | 15346783 |
| Molecular Formula | C7H6Cl2O3 |
| Molecular Weight | 209.03 g/mol |
| Exact Mass | 207.97 |
| IUPAC Name | 7,9-dichloro-1,4-dioxaspiro[4.4]non-6-en-8-one |
| SMILES | O=C1C(Cl)=CC2(OCCO2)C1Cl |
| InChI | InChI=1S/C7H6Cl2O3/c8-4-3-7(6(9)5(4)10)11-1-2-12-7/h3,6H,1-2H2 |
| InChIKey | YOTLJAMTFLQBQY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.03 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|