C22H25ClN2O4S2 — CID 15383954
5-[[4-[2-[[3-(3-chlorophenoxy)-2-hydroxypropyl]amino]propylsulfanyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 15383954) has the molecular formula C22H25ClN2O4S2 and a molecular weight of 481.04 g/mol. Its IUPAC name is 5-[[4-[2-[[3-(3-chlorophenoxy)-2-hydroxypropyl]amino]propylsulfanyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[[3-(3-chlorophenoxy)-2-hydroxypropyl]amino]propylsulfanyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 15383954 |
| Molecular Formula | C22H25ClN2O4S2 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 5-[[4-[2-[[3-(3-chlorophenoxy)-2-hydroxypropyl]amino]propylsulfanyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(CSc1ccc(CC2SC(=O)NC2=O)cc1)NCC(O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H25ClN2O4S2/c1-14(24-11-17(26)12-29-18-4-2-3-16(23)10-18)13-30-19-7-5-15(6-8-19)9-20-21(27)25-22(28)31-20/h2-8,10,14,17,20,24,26H,9,11-13H2,1H3,(H,25,27,28) |
| InChIKey | MGGLIEYTSLYMQX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|