C20H28O3 — CID 15385227
(1R,2R,4S,7S,9R,11R,13S)-4,8,8,11,15-pentamethyl-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-14-ene-12,16-dione (PubChem CID 15385227) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1R,2R,4S,7S,9R,11R,13S)-4,8,8,11,15-pentamethyl-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-14-ene-12,16-dione.
| Compound Name | (1R,2R,4S,7S,9R,11R,13S)-4,8,8,11,15-pentamethyl-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-14-ene-12,16-dione |
|---|---|
| PubChem CID | 15385227 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1R,2R,4S,7S,9R,11R,13S)-4,8,8,11,15-pentamethyl-3-oxatetracyclo[11.3.0.02,4.07,9]hexadec-14-ene-12,16-dione |
| SMILES | CC1=C[C@@H]2C(=O)[C@H](C)C[C@@H]3[C@H](CC[C@]4(C)O[C@@H]4[C@@H]2C1=O)C3(C)C |
| InChI | InChI=1S/C20H28O3/c1-10-8-12-15(17(10)22)18-20(5,23-18)7-6-13-14(19(13,3)4)9-11(2)16(12)21/h8,11-15,18H,6-7,9H2,1-5H3/t11-,12+,13+,14-,15+,18-,20+/m1/s1 |
| InChIKey | GMIOZCGSDXNFCP-JXIVHQDKSA-N |
| XLogP | 3.57 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|