C21H33NO10 — CID 15385970
methyl (1S,4aS,5S,7aS)-5-butoxy-7-(hydroxymethyl)-1-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,4a,5,7a-tetrahydro-1H-cyclopenta[c]pyridine-4-carboxylate (PubChem CID 15385970) has the molecular formula C21H33NO10 and a molecular weight of 459.49 g/mol. Its IUPAC name is methyl (1S,4aS,5S,7aS)-5-butoxy-7-(hydroxymethyl)-1-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,4a,5,7a-tetrahydro-1H-cyclopenta[c]pyridine-4-carboxylate.
| Compound Name | methyl (1S,4aS,5S,7aS)-5-butoxy-7-(hydroxymethyl)-1-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,4a,5,7a-tetrahydro-1H-cyclopenta[c]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 15385970 |
| Molecular Formula | C21H33NO10 |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | methyl (1S,4aS,5S,7aS)-5-butoxy-7-(hydroxymethyl)-1-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,4a,5,7a-tetrahydro-1H-cyclopenta[c]pyridine-4-carboxylate |
| SMILES | CCCCO[C@H]1C=C(CO)[C@@H]2[C@H]1C(C(=O)OC)=CN[C@H]2O[C@@H]1O[C@H](CO)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H33NO10/c1-3-4-5-30-12-6-10(8-23)14-15(12)11(20(28)29-2)7-22-19(14)32-21-18(27)17(26)16(25)13(9-24)31-21/h6-7,12-19,21-27H,3-5,8-9H2,1-2H3/t12-,13+,14+,15-,16-,17+,18+,19-,21-/m0/s1 |
| InChIKey | CZOIHQDUBCLPKS-HUDZDLGOSA-N |
| XLogP | -1.86 |
| TPSA | 167.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|