C21H32O11 — CID 10766383
methyl (1R,4aS,5R,7aS)-5-butoxy-7-(hydroxymethyl)-1-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 10766383) has the molecular formula C21H32O11 and a molecular weight of 460.48 g/mol. Its IUPAC name is methyl (1R,4aS,5R,7aS)-5-butoxy-7-(hydroxymethyl)-1-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1R,4aS,5R,7aS)-5-butoxy-7-(hydroxymethyl)-1-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 10766383 |
| Molecular Formula | C21H32O11 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | methyl (1R,4aS,5R,7aS)-5-butoxy-7-(hydroxymethyl)-1-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | CCCCO[C@@H]1C=C(CO)[C@H]2[C@H](OC[C@H]3O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]3O)OC=C(C(=O)OC)[C@H]21 |
| InChI | InChI=1S/C21H32O11/c1-3-4-5-29-12-6-10(7-22)14-15(12)11(19(26)28-2)8-30-21(14)31-9-13-16(23)17(24)18(25)20(27)32-13/h6,8,12-18,20-25,27H,3-5,7,9H2,1-2H3/t12-,13-,14-,15+,16-,17+,18-,20-,21+/m1/s1 |
| InChIKey | AVVMCQQTDTWJCI-AVTOBRDMSA-N |
| XLogP | -1.43 |
| TPSA | 164.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|