C20H37NO6Si — CID 15386081
1-O-tert-butyl 3-O-ethyl 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxopiperidine-1,3-dicarboxylate (PubChem CID 15386081) has the molecular formula C20H37NO6Si and a molecular weight of 415.60 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxopiperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxopiperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 15386081 |
| Molecular Formula | C20H37NO6Si |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxopiperidine-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1CC(CO[Si](C)(C)C(C)(C)C)CN(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C20H37NO6Si/c1-10-25-17(23)15-11-14(13-26-28(8,9)20(5,6)7)12-21(16(15)22)18(24)27-19(2,3)4/h14-15H,10-13H2,1-9H3 |
| InChIKey | BYPQKXWMIIEGHY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|