C12H15N3O3 — CID 15388853
1-hydroxy-1-[1-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethyl]urea (PubChem CID 15388853) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-hydroxy-1-[1-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethyl]urea.
| Compound Name | 1-hydroxy-1-[1-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 15388853 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 1-hydroxy-1-[1-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)ethyl]urea |
| SMILES | CC(C1CC(c2ccccc2)=NO1)N(O)C(N)=O |
| InChI | InChI=1S/C12H15N3O3/c1-8(15(17)12(13)16)11-7-10(14-18-11)9-5-3-2-4-6-9/h2-6,8,11,17H,7H2,1H3,(H2,13,16) |
| InChIKey | YQZJQUUAPWYKQW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|