About N,N'-bis(1-adamantyl)-2,2-dimethylpropanimidamide
N,N'-bis(1-adamantyl)-2,2-dimethylpropanimidamide (PubChem CID 15393138) has the molecular formula C25H40N2
and a molecular weight of 368.61 g/mol. Its IUPAC name is N,N'-bis(1-adamantyl)-2,2-dimethylpropanimidamide.
Molecular Properties
| Compound Name | N,N'-bis(1-adamantyl)-2,2-dimethylpropanimidamide |
| PubChem CID | 15393138 |
| Molecular Formula | C25H40N2 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.32 |
| IUPAC Name | N,N'-bis(1-adamantyl)-2,2-dimethylpropanimidamide |
| SMILES | CC(C)(C)/C(=N\C12CC3CC(CC(C3)C1)C2)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H40N2/c1-23(2,3)22(26-24-10-16-4-17(11-24)6-18(5-16)12-24)27-25-13-19-7-20(14-25)9-21(8-19)15-25/h16-21H,4-15H2,1-3H3,(H,26,27) |
| InChIKey | BQYCDESNICGMQC-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(1-adamantyl)-2,2-dimethylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(1-adamantyl)-2,2-dimethylpropanimidamide?
The IUPAC name of N,N'-bis(1-adamantyl)-2,2-dimethylpropanimidamide (CID 15393138) is N,N'-bis(1-adamantyl)-2,2-dimethylpropanimidamide.
What is the SMILES notation for N,N'-bis(1-adamantyl)-2,2-dimethylpropanimidamide?
The canonical SMILES for N,N'-bis(1-adamantyl)-2,2-dimethylpropanimidamide is CC(C)(C)/C(=N\C12CC3CC(CC(C3)C1)C2)NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N,N'-bis(1-adamantyl)-2,2-dimethylpropanimidamide?
The InChIKey is BQYCDESNICGMQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H40N2/c1-23(2,3)22(26-24-10-16-4-17(11-24)6-18(5-16)12-24)27-25-13-19-7-20(14-25)9-21(8-19)15-25/h16-21H,4-15H2,1-3H3,(H,26,27).
What are the key properties of N,N'-bis(1-adamantyl)-2,2-dimethylpropanimidamide?
N,N'-bis(1-adamantyl)-2,2-dimethylpropanimidamide has a molecular weight of 368.61 g/mol, XLogP of 5.96, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(1-adamantyl)-2,2-dimethylpropanimidamide is sourced from PubChem (CID 15393138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).