C22H36N6 — CID 21197367
2,3-bis(1-adamantyl)-1-amino-1-carbamimidoylguanidine (PubChem CID 21197367) has the molecular formula C22H36N6 and a molecular weight of 384.57 g/mol. Its IUPAC name is 2,3-bis(1-adamantyl)-1-amino-1-carbamimidoylguanidine.
| Compound Name | 2,3-bis(1-adamantyl)-1-amino-1-carbamimidoylguanidine |
|---|---|
| PubChem CID | 21197367 |
| Molecular Formula | C22H36N6 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 2,3-bis(1-adamantyl)-1-amino-1-carbamimidoylguanidine |
| SMILES | [H]/N=C(\N)N(N)/C(=N\C12CC3CC(CC(C3)C1)C2)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H36N6/c23-19(24)28(25)20(26-21-7-13-1-14(8-21)3-15(2-13)9-21)27-22-10-16-4-17(11-22)6-18(5-16)12-22/h13-18H,1-12,25H2,(H3,23,24)(H,26,27) |
| InChIKey | YDCVYONJZXZFOU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|