C21H33N3 — CID 18783168
1,1-bis(1-adamantyl)guanidine (PubChem CID 18783168) has the molecular formula C21H33N3 and a molecular weight of 327.52 g/mol. Its IUPAC name is 1,1-bis(1-adamantyl)guanidine.
| Compound Name | 1,1-bis(1-adamantyl)guanidine |
|---|---|
| PubChem CID | 18783168 |
| Molecular Formula | C21H33N3 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.27 |
| IUPAC Name | 1,1-bis(1-adamantyl)guanidine |
| SMILES | [H]/N=C(\N)N(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H33N3/c22-19(23)24(20-7-13-1-14(8-20)3-15(2-13)9-20)21-10-16-4-17(11-21)6-18(5-16)12-21/h13-18H,1-12H2,(H3,22,23) |
| InChIKey | PMSOXCJUJLNDME-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|