C28H44N4 — CID 171722216
1-N',4-N'-bis(1-adamantyl)cyclohexane-1,4-dicarboximidamide (PubChem CID 171722216) has the molecular formula C28H44N4 and a molecular weight of 436.69 g/mol. Its IUPAC name is 1-N',4-N'-bis(1-adamantyl)cyclohexane-1,4-dicarboximidamide.
| Compound Name | 1-N',4-N'-bis(1-adamantyl)cyclohexane-1,4-dicarboximidamide |
|---|---|
| PubChem CID | 171722216 |
| Molecular Formula | C28H44N4 |
| Molecular Weight | 436.69 g/mol |
| Exact Mass | 436.36 |
| IUPAC Name | 1-N',4-N'-bis(1-adamantyl)cyclohexane-1,4-dicarboximidamide |
| SMILES | N/C(=N\C12CC3CC(CC(C3)C1)C2)C1CCC(/C(N)=N/C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C28H44N4/c29-25(31-27-11-17-5-18(12-27)7-19(6-17)13-27)23-1-2-24(4-3-23)26(30)32-28-14-20-8-21(15-28)10-22(9-20)16-28/h17-24H,1-16H2,(H2,29,31)(H2,30,32) |
| InChIKey | HRNRYYMOKCSXOM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.69 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|