About 1-(18O)nitrosoadamantane
1-(18O)nitrosoadamantane (PubChem CID 10080757) has the molecular formula C10H15NO
and a molecular weight of 167.24 g/mol. Its IUPAC name is 1-(18O)nitrosoadamantane.
Molecular Properties
| Compound Name | 1-(18O)nitrosoadamantane |
| PubChem CID | 10080757 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 1-(18O)nitrosoadamantane |
| SMILES | [18O]=NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H15NO/c12-11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2/i12+2 |
| InChIKey | NXYRRNWKCSMROR-HVRMQOCCSA-N |
| XLogP | 2.72 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(18O)nitrosoadamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(18O)nitrosoadamantane?
The IUPAC name of 1-(18O)nitrosoadamantane (CID 10080757) is 1-(18O)nitrosoadamantane.
What is the SMILES notation for 1-(18O)nitrosoadamantane?
The canonical SMILES for 1-(18O)nitrosoadamantane is [18O]=NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(18O)nitrosoadamantane?
The InChIKey is NXYRRNWKCSMROR-HVRMQOCCSA-N. The full InChI is InChI=1S/C10H15NO/c12-11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2/i12+2.
What are the key properties of 1-(18O)nitrosoadamantane?
1-(18O)nitrosoadamantane has a molecular weight of 167.24 g/mol, XLogP of 2.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(18O)nitrosoadamantane is sourced from PubChem (CID 10080757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).