C21H22ClN3O2 — CID 15396792
ethyl 3-(2-chlorophenyl)-2-(4-methylphenyl)-4-prop-2-enyl-3H-1,2,4-triazole-5-carboxylate (PubChem CID 15396792) has the molecular formula C21H22ClN3O2 and a molecular weight of 383.88 g/mol. Its IUPAC name is ethyl 3-(2-chlorophenyl)-2-(4-methylphenyl)-4-prop-2-enyl-3H-1,2,4-triazole-5-carboxylate.
| Compound Name | ethyl 3-(2-chlorophenyl)-2-(4-methylphenyl)-4-prop-2-enyl-3H-1,2,4-triazole-5-carboxylate |
|---|---|
| PubChem CID | 15396792 |
| Molecular Formula | C21H22ClN3O2 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | ethyl 3-(2-chlorophenyl)-2-(4-methylphenyl)-4-prop-2-enyl-3H-1,2,4-triazole-5-carboxylate |
| SMILES | C=CCN1C(C(=O)OCC)=NN(c2ccc(C)cc2)C1c1ccccc1Cl |
| InChI | InChI=1S/C21H22ClN3O2/c1-4-14-24-19(21(26)27-5-2)23-25(16-12-10-15(3)11-13-16)20(24)17-8-6-7-9-18(17)22/h4,6-13,20H,1,5,14H2,2-3H3 |
| InChIKey | HEASOCOCELLVLR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|