C25H25Br2N5O6 — CID 139248661
triethyl 1,6-bis(4-bromophenyl)-5,8a-dihydro-[1,2,4]triazolo[4,3-d][1,2,4]triazine-3,5,8-tricarboxylate (PubChem CID 139248661) has the molecular formula C25H25Br2N5O6 and a molecular weight of 651.31 g/mol. Its IUPAC name is triethyl 1,6-bis(4-bromophenyl)-5,8a-dihydro-[1,2,4]triazolo[4,3-d][1,2,4]triazine-3,5,8-tricarboxylate.
| Compound Name | triethyl 1,6-bis(4-bromophenyl)-5,8a-dihydro-[1,2,4]triazolo[4,3-d][1,2,4]triazine-3,5,8-tricarboxylate |
|---|---|
| PubChem CID | 139248661 |
| Molecular Formula | C25H25Br2N5O6 |
| Molecular Weight | 651.31 g/mol |
| Exact Mass | 649.02 |
| IUPAC Name | triethyl 1,6-bis(4-bromophenyl)-5,8a-dihydro-[1,2,4]triazolo[4,3-d][1,2,4]triazine-3,5,8-tricarboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccc(Br)cc2)C(C(=O)OCC)N2C(C(=O)OCC)=NN(c3ccc(Br)cc3)C12 |
| InChI | InChI=1S/C25H25Br2N5O6/c1-4-36-23(33)19-21-30(20(24(34)37-5-2)29-31(21)17-11-7-15(26)8-12-17)22(25(35)38-6-3)32(28-19)18-13-9-16(27)10-14-18/h7-14,21-22H,4-6H2,1-3H3 |
| InChIKey | OMCHYGNUWRKEPX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 113.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|