C19H16F3N3O — CID 154002152
2-(1-ethylindol-2-yl)-1-methyl-7-(trifluoromethoxy)benzimidazole (PubChem CID 154002152) has the molecular formula C19H16F3N3O and a molecular weight of 359.35 g/mol. Its IUPAC name is 2-(1-ethylindol-2-yl)-1-methyl-7-(trifluoromethoxy)benzimidazole.
| Compound Name | 2-(1-ethylindol-2-yl)-1-methyl-7-(trifluoromethoxy)benzimidazole |
|---|---|
| PubChem CID | 154002152 |
| Molecular Formula | C19H16F3N3O |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 2-(1-ethylindol-2-yl)-1-methyl-7-(trifluoromethoxy)benzimidazole |
| SMILES | CCn1c(-c2nc3cccc(OC(F)(F)F)c3n2C)cc2ccccc21 |
| InChI | InChI=1S/C19H16F3N3O/c1-3-25-14-9-5-4-7-12(14)11-15(25)18-23-13-8-6-10-16(17(13)24(18)2)26-19(20,21)22/h4-11H,3H2,1-2H3 |
| InChIKey | RFOSWJQWBWPVST-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |