C28H34OSi2 — CID 15401586
tert-butyl-dimethyl-[1-[2-(2-phenylethynyl)phenyl]-5-trimethylsilylpenta-2,4-diynoxy]silane (PubChem CID 15401586) has the molecular formula C28H34OSi2 and a molecular weight of 442.75 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1-[2-(2-phenylethynyl)phenyl]-5-trimethylsilylpenta-2,4-diynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[1-[2-(2-phenylethynyl)phenyl]-5-trimethylsilylpenta-2,4-diynoxy]silane |
|---|---|
| PubChem CID | 15401586 |
| Molecular Formula | C28H34OSi2 |
| Molecular Weight | 442.75 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | tert-butyl-dimethyl-[1-[2-(2-phenylethynyl)phenyl]-5-trimethylsilylpenta-2,4-diynoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC(C#CC#C[Si](C)(C)C)c1ccccc1C#Cc1ccccc1 |
| InChI | InChI=1S/C28H34OSi2/c1-28(2,3)31(7,8)29-27(20-14-15-23-30(4,5)6)26-19-13-12-18-25(26)22-21-24-16-10-9-11-17-24/h9-13,16-19,27H,1-8H3 |
| InChIKey | DBZXOGAICKOVMC-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.75 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|