C30H42O4Si2 — CID 134923304
3-[2-[1-[tert-butyl(dimethyl)silyl]oxy-3-[3-[tert-butyl(dimethyl)silyl]oxy-6-oxocyclohexen-1-yl]prop-2-ynyl]phenyl]prop-2-ynal (PubChem CID 134923304) has the molecular formula C30H42O4Si2 and a molecular weight of 522.83 g/mol. Its IUPAC name is 3-[2-[1-[tert-butyl(dimethyl)silyl]oxy-3-[3-[tert-butyl(dimethyl)silyl]oxy-6-oxocyclohexen-1-yl]prop-2-ynyl]phenyl]prop-2-ynal.
| Compound Name | 3-[2-[1-[tert-butyl(dimethyl)silyl]oxy-3-[3-[tert-butyl(dimethyl)silyl]oxy-6-oxocyclohexen-1-yl]prop-2-ynyl]phenyl]prop-2-ynal |
|---|---|
| PubChem CID | 134923304 |
| Molecular Formula | C30H42O4Si2 |
| Molecular Weight | 522.83 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 3-[2-[1-[tert-butyl(dimethyl)silyl]oxy-3-[3-[tert-butyl(dimethyl)silyl]oxy-6-oxocyclohexen-1-yl]prop-2-ynyl]phenyl]prop-2-ynal |
| SMILES | CC(C)(C)[Si](C)(C)OC1C=C(C#CC(O[Si](C)(C)C(C)(C)C)c2ccccc2C#CC=O)C(=O)CC1 |
| InChI | InChI=1S/C30H42O4Si2/c1-29(2,3)35(7,8)33-25-18-19-27(32)24(22-25)17-20-28(34-36(9,10)30(4,5)6)26-16-12-11-14-23(26)15-13-21-31/h11-12,14,16,21-22,25,28H,18-19H2,1-10H3 |
| InChIKey | YQTBQZACSXHISM-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.83 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|