C10H31NO3Si4 — CID 154027706
N-[[bis(dimethylsilyloxy)-methylsilyl]oxy-dimethylsilyl]propan-1-amine (PubChem CID 154027706) has the molecular formula C10H31NO3Si4 and a molecular weight of 325.71 g/mol. Its IUPAC name is N-[[bis(dimethylsilyloxy)-methylsilyl]oxy-dimethylsilyl]propan-1-amine.
| Compound Name | N-[[bis(dimethylsilyloxy)-methylsilyl]oxy-dimethylsilyl]propan-1-amine |
|---|---|
| PubChem CID | 154027706 |
| Molecular Formula | C10H31NO3Si4 |
| Molecular Weight | 325.71 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-[[bis(dimethylsilyloxy)-methylsilyl]oxy-dimethylsilyl]propan-1-amine |
| SMILES | CCCN[Si](C)(C)O[Si](C)(O[SiH](C)C)O[SiH](C)C |
| InChI | InChI=1S/C10H31NO3Si4/c1-9-10-11-17(6,7)14-18(8,12-15(2)3)13-16(4)5/h11,15-16H,9-10H2,1-8H3 |
| InChIKey | NEXNIUZBLBVBAL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|