C9H29NO3Si4 — CID 154027704
N-[[bis(dimethylsilyloxy)-ethylsilyl]oxy-dimethylsilyl]methanamine (PubChem CID 154027704) has the molecular formula C9H29NO3Si4 and a molecular weight of 311.68 g/mol. Its IUPAC name is N-[[bis(dimethylsilyloxy)-ethylsilyl]oxy-dimethylsilyl]methanamine.
| Compound Name | N-[[bis(dimethylsilyloxy)-ethylsilyl]oxy-dimethylsilyl]methanamine |
|---|---|
| PubChem CID | 154027704 |
| Molecular Formula | C9H29NO3Si4 |
| Molecular Weight | 311.68 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-[[bis(dimethylsilyloxy)-ethylsilyl]oxy-dimethylsilyl]methanamine |
| SMILES | CC[Si](O[SiH](C)C)(O[SiH](C)C)O[Si](C)(C)NC |
| InChI | InChI=1S/C9H29NO3Si4/c1-9-17(11-14(3)4,12-15(5)6)13-16(7,8)10-2/h10,14-15H,9H2,1-8H3 |
| InChIKey | REIBZJIRWFNSIX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.68 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|