C8H25NO2Si3 — CID 154027702
N-[(dimethylsilyloxy-ethyl-methylsilyl)oxy-dimethylsilyl]methanamine (PubChem CID 154027702) has the molecular formula C8H25NO2Si3 and a molecular weight of 251.55 g/mol. Its IUPAC name is N-[(dimethylsilyloxy-ethyl-methylsilyl)oxy-dimethylsilyl]methanamine.
| Compound Name | N-[(dimethylsilyloxy-ethyl-methylsilyl)oxy-dimethylsilyl]methanamine |
|---|---|
| PubChem CID | 154027702 |
| Molecular Formula | C8H25NO2Si3 |
| Molecular Weight | 251.55 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-[(dimethylsilyloxy-ethyl-methylsilyl)oxy-dimethylsilyl]methanamine |
| SMILES | CC[Si](C)(O[SiH](C)C)O[Si](C)(C)NC |
| InChI | InChI=1S/C8H25NO2Si3/c1-8-14(7,10-12(3)4)11-13(5,6)9-2/h9,12H,8H2,1-7H3 |
| InChIKey | FGDVWIMALLONGR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|