C25H40N2O5 — CID 154028168
(2R)-2-[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]-2-(pyrrolidin-1-ylmethyl)azetidine-1-carboxylic acid (PubChem CID 154028168) has the molecular formula C25H40N2O5 and a molecular weight of 448.60 g/mol. Its IUPAC name is (2R)-2-[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]-2-(pyrrolidin-1-ylmethyl)azetidine-1-carboxylic acid.
| Compound Name | (2R)-2-[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]-2-(pyrrolidin-1-ylmethyl)azetidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154028168 |
| Molecular Formula | C25H40N2O5 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | (2R)-2-[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]-2-(pyrrolidin-1-ylmethyl)azetidine-1-carboxylic acid |
| SMILES | CO[C@@H]1[C@H]([C@@]2(C)O[C@@H]2CC=C(C)C)[C@]2(CC[C@@H]1[C@@]1(CN3CCCC3)CCN1C(=O)O)CO2 |
| InChI | InChI=1S/C25H40N2O5/c1-17(2)7-8-19-23(3,32-19)21-20(30-4)18(9-10-25(21)16-31-25)24(11-14-27(24)22(28)29)15-26-12-5-6-13-26/h7,18-21H,5-6,8-16H2,1-4H3,(H,28,29)/t18-,19+,20-,21+,23-,24-,25-/m0/s1 |
| InChIKey | WVHRCAIVUNYPCK-MHFKKGHZSA-N |
| XLogP | 3.53 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|