C27H46N2O5 — CID 154028189
(2R,3R)-3-[2-(diethylamino)ethyl]-2-[(4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]pyrrolidine-1-carboxylic acid (PubChem CID 154028189) has the molecular formula C27H46N2O5 and a molecular weight of 478.67 g/mol. Its IUPAC name is (2R,3R)-3-[2-(diethylamino)ethyl]-2-[(4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2R,3R)-3-[2-(diethylamino)ethyl]-2-[(4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154028189 |
| Molecular Formula | C27H46N2O5 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | (2R,3R)-3-[2-(diethylamino)ethyl]-2-[(4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]pyrrolidine-1-carboxylic acid |
| SMILES | CCN(CC)CC[C@@H]1CCN(C(=O)O)[C@H]1[C@H]1CCC2(CO2)[C@@H]([C@@]2(C)O[C@@H]2CC=C(C)C)[C@H]1OC |
| InChI | InChI=1S/C27H46N2O5/c1-7-28(8-2)15-12-19-13-16-29(25(30)31)22(19)20-11-14-27(17-33-27)24(23(20)32-6)26(5)21(34-26)10-9-18(3)4/h9,19-24H,7-8,10-17H2,1-6H3,(H,30,31)/t19-,20-,21-,22-,23+,24-,26+,27?/m1/s1 |
| InChIKey | IRVZCLFASXXEGR-UONDTVPUSA-N |
| XLogP | 4.41 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|