C18H19ClN4O2S — CID 154034454
N-[4-chloro-2-[4-[(dimethylamino)methyl]pyrazol-1-yl]phenyl]benzenesulfonamide (PubChem CID 154034454) has the molecular formula C18H19ClN4O2S and a molecular weight of 390.90 g/mol. Its IUPAC name is N-[4-chloro-2-[4-[(dimethylamino)methyl]pyrazol-1-yl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-chloro-2-[4-[(dimethylamino)methyl]pyrazol-1-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 154034454 |
| Molecular Formula | C18H19ClN4O2S |
| Molecular Weight | 390.90 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-[4-chloro-2-[4-[(dimethylamino)methyl]pyrazol-1-yl]phenyl]benzenesulfonamide |
| SMILES | CN(C)Cc1cnn(-c2cc(Cl)ccc2NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H19ClN4O2S/c1-22(2)12-14-11-20-23(13-14)18-10-15(19)8-9-17(18)21-26(24,25)16-6-4-3-5-7-16/h3-11,13,21H,12H2,1-2H3 |
| InChIKey | YEVBJXMZXCXTDC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.90 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |