C16H14ClN3O3S — CID 154034450
N-[4-chloro-2-[4-(hydroxymethyl)pyrazol-1-yl]phenyl]benzenesulfonamide (PubChem CID 154034450) has the molecular formula C16H14ClN3O3S and a molecular weight of 363.83 g/mol. Its IUPAC name is N-[4-chloro-2-[4-(hydroxymethyl)pyrazol-1-yl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-chloro-2-[4-(hydroxymethyl)pyrazol-1-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 154034450 |
| Molecular Formula | C16H14ClN3O3S |
| Molecular Weight | 363.83 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N-[4-chloro-2-[4-(hydroxymethyl)pyrazol-1-yl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1-n1cc(CO)cn1)c1ccccc1 |
| InChI | InChI=1S/C16H14ClN3O3S/c17-13-6-7-15(16(8-13)20-10-12(11-21)9-18-20)19-24(22,23)14-4-2-1-3-5-14/h1-10,19,21H,11H2 |
| InChIKey | DLGHQNBNEWJRAH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.83 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |